N,N-Dimethylcarbamic acid 2-(carbamoyloxymethyl)-2,3-dimethylpentyl ester
Modify Date: 2025-10-08 12:31:04
N,N-Dimethylcarbamic acid 2-(carbamoyloxymethyl)-2,3-dimethylpentyl ester structure
|
Common Name | N,N-Dimethylcarbamic acid 2-(carbamoyloxymethyl)-2,3-dimethylpentyl ester | ||
|---|---|---|---|---|
| CAS Number | 25642-76-6 | Molecular Weight | 260.33000 | |
| Density | 1.062g/cm3 | Boiling Point | 389.9ºC at 760mmHg | |
| Molecular Formula | C12H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | [2-(carbamoyloxymethyl)-2,3-dimethylpentyl] N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 389.9ºC at 760mmHg |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33000 |
| Flash Point | 189.6ºC |
| Exact Mass | 260.17400 |
| PSA | 82.85000 |
| LogP | 2.34610 |
| Vapour Pressure | 2.76E-06mmHg at 25°C |
| Index of Refraction | 1.47 |
| InChIKey | PMMKVFWFTRDMLW-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C)(COC(N)=O)COC(=O)N(C)C |
| HS Code | 2924199090 |
|---|
|
~%
N,N-Dimethylcar... CAS#:25642-76-6 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(carbamoyloxy)methyl]-2,3-dimethylpentyl dimethylcarbamate |
| 1,3-Propanediol,2-sec-butyl-2-methyl-,carbamate,dimethylcarbamate |
| 2-sec-Butyl-2-methyl-1,3-propanediol carbamate dimethylcarbamate |
| N,N,2-Trimethyl-2-sek.-butyl-1,3-dicarbamoyl-oxy-propan |