Acetamide,2,2,2-trichloro-N-(3-methylphenyl)- structure
|
Common Name | Acetamide,2,2,2-trichloro-N-(3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2563-96-4 | Molecular Weight | 252.52500 | |
| Density | 1.459g/cm3 | Boiling Point | 332.8ºC at 760mmHg | |
| Molecular Formula | C9H8Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | 2,2,2-trichloro-N-(3-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 332.8ºC at 760mmHg |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.52500 |
| Flash Point | 155.1ºC |
| Exact Mass | 250.96700 |
| PSA | 29.10000 |
| LogP | 3.37670 |
| Vapour Pressure | 0.000142mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | WJTMDWHORSRZQN-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)C(Cl)(Cl)Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,2,2,2... CAS#:2563-96-4 |
| Literature: McGookin Journal of the Society of Chemical Industry, London, 1948 , vol. 67, p. 23 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| trichloro-acetic acid m-toluidide |
| Trichloressigsaeure-m-toluidid |
| 3-Methyltrichloracetanilid |
| N-Trichloracetyl-m-toluidin |