Lysinenorleucine structure
|
Common Name | Lysinenorleucine | ||
|---|---|---|---|---|
| CAS Number | 25612-46-8 | Molecular Weight | 275.34500 | |
| Density | 1.182g/cm3 | Boiling Point | 505.4ºC at 760 mmHg | |
| Molecular Formula | C12H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.4ºC | |
Use of LysinenorleucineLysinenorleucine s a Lysine and hydroxylysine derivatives for treatment of malignant and benign tumors. |
| Name | Lysinonorleucine |
|---|
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 505.4ºC at 760 mmHg |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.34500 |
| Flash Point | 259.4ºC |
| Exact Mass | 275.18500 |
| PSA | 138.67000 |
| LogP | 1.53190 |
| Vapour Pressure | 1.39E-11mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | HYLBTMZBXLEVCL-UWVGGRQHSA-N |
| SMILES | NC(CCCCNCCCCC(N)C(=O)O)C(=O)O |