4-[(4-bromophenyl)amino]-4-oxobutanoic acid
Modify Date: 2025-08-21 01:31:52
![4-[(4-bromophenyl)amino]-4-oxobutanoic acid Structure](https://image.chemsrc.com/caspic/161/25589-41-7.png)
4-[(4-bromophenyl)amino]-4-oxobutanoic acid structure
|
Common Name | 4-[(4-bromophenyl)amino]-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 25589-41-7 | Molecular Weight | 272.09500 | |
| Density | 1.635g/cm3 | Boiling Point | 501.1ºC at 760 mmHg | |
| Molecular Formula | C10H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
| Name | 4-(4-bromoanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.635g/cm3 |
|---|---|
| Boiling Point | 501.1ºC at 760 mmHg |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.09500 |
| Flash Point | 256.8ºC |
| Exact Mass | 270.98400 |
| PSA | 66.40000 |
| LogP | 2.32540 |
| Vapour Pressure | 7.35E-11mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | MJQBQVIGARYLLU-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
|
~65%
4-[(4-bromophen... CAS#:25589-41-7 |
| Literature: Kumar, Padam Praveen; Rama Devi; Dubey Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2013 , vol. 52, # 8 p. 1166 - 1171 |
|
~%
4-[(4-bromophen... CAS#:25589-41-7 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 9, p. 54 |
CAS#:41167-74-2| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(4-bromophenyl)carbamoyl]propanoic acid |
| succinic acid mono-4-bromoanilide |
| Bernsteinsaeure-mono-(4-brom-anilid) |
| Butanoic acid,4-[(4-bromophenyl)amino]-4-oxo |
| 4-((4-bromophenyl)amino)-4-oxobutanoic acid |
| N-(4-Brom-phenyl)-succinamidsaeure |
| N-(4-bromo-phenyl)-succinamic acid |
| 4-Brom-succinanilsaeure |