4'-Methoxy-α-(1-pyrrolidinylimino)acetophenone
Modify Date: 2025-08-26 16:24:28
4'-Methoxy-α-(1-pyrrolidinylimino)acetophenone structure
|
Common Name | 4'-Methoxy-α-(1-pyrrolidinylimino)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 25555-21-9 | Molecular Weight | 232.27800 | |
| Density | 1.143g/cm3 | Boiling Point | 378.772ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.875ºC | |
| Name | 1-(4-methoxyphenyl)-2-pyrrolidin-1-yliminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 378.772ºC at 760 mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 182.875ºC |
| Exact Mass | 232.12100 |
| PSA | 41.90000 |
| LogP | 1.89740 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | KPCCWMVIFFIQGS-GXDHUFHOSA-N |
| SMILES | COc1ccc(C(=O)C=NN2CCCC2)cc1 |
| HS Code | 2933990090 |
|---|
|
~35%
4'-Methoxy-α-(1... CAS#:25555-21-9 |
| Literature: Brehme, Rainer Chemische Berichte, 1990 , vol. 123, # 10 p. 2039 - 2046 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethanone,1-(4-methoxyphenyl)-2-(1-pyrrolidinylimino) |
| 1-(4-Methoxyphenyl)glyoxal-2-tetramethylenhydrazon |
| Acetophenone,4'-methoxy-2-(1-pyrrolidinylimino)-(8CI) |