3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate,(2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid structure
|
Common Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate,(2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 254972-16-2 | Molecular Weight | 844.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H54ClN7O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate,(2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C44H54ClN7O8 |
|---|---|
| Molecular Weight | 844.39500 |
| Exact Mass | 843.37200 |
| PSA | 211.95000 |
| LogP | 7.45710 |
| InChIKey | QWCYQCQLAZCPHO-FTBISJDPSA-N |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)C(C(=O)O)C(C)C.CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl |
| Valsartan mixture with amlodipine |
| amlodipine,valsartan drug combination |
| Dafiro |
| Imprida |
| Amlodipine valsartan |
| Amlodipine mixture with valsartan |
| Copalia |