N-Butylcarbamic acid 2-(carbamoyloxymethyl)-2-ethylbutyl ester structure
|
Common Name | N-Butylcarbamic acid 2-(carbamoyloxymethyl)-2-ethylbutyl ester | ||
|---|---|---|---|---|
| CAS Number | 25385-20-0 | Molecular Weight | 274.35700 | |
| Density | 1.044g/cm3 | Boiling Point | 441ºC at 760mmHg | |
| Molecular Formula | C13H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5ºC | |
| Name | [2-(carbamoyloxymethyl)-2-ethylbutyl] N-butylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 441ºC at 760mmHg |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.35700 |
| Flash Point | 220.5ºC |
| Exact Mass | 274.18900 |
| PSA | 95.13000 |
| LogP | 3.13260 |
| Vapour Pressure | 5.63E-08mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | HNVFEIFBCWEIOW-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)OCC(CC)(CC)COC(N)=O |
| HS Code | 2924199090 |
|---|
|
~%
N-Butylcarbamic... CAS#:25385-20-0 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-Diethyl-1,3-propanediol butylcarbamate carbamate |
| N-Butyl-2,2-diaethyl-1,3-dicarbamoyloxy-propan |
| A5169 |
| 2-[(carbamoyloxy)methyl]-2-ethylbutyl butylcarbamate |
| 1,3-Propanediol,2,2-diethyl-,butylcarbamate,carbamate |