Hexanedioic acid,3,4-diphenyl- structure
|
Common Name | Hexanedioic acid,3,4-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 25347-44-8 | Molecular Weight | 298.33300 | |
| Density | 1.244g/cm3 | Boiling Point | 436.6ºC at 760mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | 3,4-diphenylhexanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 232ºC |
| Exact Mass | 298.12100 |
| PSA | 74.60000 |
| LogP | 3.50340 |
| Vapour Pressure | 2.15E-08mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | CDAXWFKYGWELRY-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1ccccc1)C(CC(=O)O)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hexanedioic acid,3,4-diphenyl |
| 3,4-Diphenyl-adipinsaeure |
| 2.3-Diphenyl-butan-dicarbonsaeure-(1.4) |
| 3,4-diphenyl-adipic acid |