3-Pyrrolidinecarboxylic acid, 5-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]- structure
|
Common Name | 3-Pyrrolidinecarboxylic acid, 5-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 253178-82-4 | Molecular Weight | 287.23400 | |
| Density | 1.433g/cm3 | Boiling Point | 462.6ºC at 760mmHg | |
| Molecular Formula | C13H12F3NO3 | Melting Point | 127.5ºC | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | 5-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 462.6ºC at 760mmHg |
| Melting Point | 127.5ºC |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.23400 |
| Flash Point | 233.6ºC |
| Exact Mass | 287.07700 |
| PSA | 57.61000 |
| LogP | 2.07640 |
| Vapour Pressure | 2.35E-09mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | MNYHTPPMXLOVSD-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC(=O)N(Cc2ccc(C(F)(F)F)cc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-oxo-1-{[4-(trifluoromethyl)phenyl]methyl}pyrrolidine-3-carboxylic acid |
| 5-oxo-1-[4-(trifluoromethyl)benzyl]pyrrolidine-3-carboxylic acid |
| 3-Pyrrolidinecarboxylic acid, 5-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]- |