Ethanesulfonic acid, compd. with N-[[2-[2-chloro-4- (4,6-diamino-2, 2-dimethyl-s-triazin-1(2H)-yl)phenoxy]ethyl]carbamoyl]sulfanilyl fluoride (1:1) (8CI) (MF2) structure
|
Common Name | Ethanesulfonic acid, compd. with N-[[2-[2-chloro-4- (4,6-diamino-2, 2-dimethyl-s-triazin-1(2H)-yl)phenoxy]ethyl]carbamoyl]sulfanilyl fluoride (1:1) (8CI) (MF2) | ||
|---|---|---|---|---|
| CAS Number | 25313-09-1 | Molecular Weight | 622.09000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29ClFN7O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]ethylcarbamoylamino]benzenesulfonyl fluoride,ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H29ClFN7O7S2 |
|---|---|
| Molecular Weight | 622.09000 |
| Exact Mass | 621.12400 |
| PSA | 235.63000 |
| LogP | 5.24060 |
| InChIKey | JHUYZFZLEIQAFV-UHFFFAOYSA-N |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(OCCNC(=O)Nc2ccc(S(=O)(=O)F)cc2)c(Cl)c1.CCS(=O)(=O)O |
| 4-[2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]ethylcarbamoylamino]benzenesulfonyl fluoride |
| ethanesulfonic acid-4-[({2-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1(2h)-yl)phenoxy]ethyl}carbamoyl)amino]benzenesulfonyl fluoride(1:1) |