1-phosphonooctylphosphonic acid
Modify Date: 2025-09-22 08:52:15
1-phosphonooctylphosphonic acid structure
|
Common Name | 1-phosphonooctylphosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 2530-50-9 | Molecular Weight | 274.18800 | |
| Density | 1.375g/cm3 | Boiling Point | 509.9ºC at 760mmHg | |
| Molecular Formula | C8H20O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
| Name | 1-phosphonooctylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 509.9ºC at 760mmHg |
| Molecular Formula | C8H20O6P2 |
| Molecular Weight | 274.18800 |
| Flash Point | 262.2ºC |
| Exact Mass | 274.07400 |
| PSA | 134.68000 |
| LogP | 2.02840 |
| Vapour Pressure | 8.97E-12mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | ROKLPPRTPHAGFK-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(P(=O)(O)O)P(=O)(O)O |
|
~%
1-phosphonoocty... CAS#:2530-50-9 |
| Literature: Szajnman, Sergio H.; Montalvetti, Andrea; Wang, Youhong; Docampo, Roberto; Rodriguez, Juan B. Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 19 p. 3231 - 3235 |
| Octylidenebisphosphonic acid |
| Phosphonic acid,octylidenebis |
| octane-1,1-diphosphonic acid |
| Octylidenediphosphonic acid |
| Phosphonic acid,octylidenedi |