4-(Boc-amino)-1-Cbz-piperidine-4-carboxylic Acid structure
|
Common Name | 4-(Boc-amino)-1-Cbz-piperidine-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 252720-32-4 | Molecular Weight | 378.419 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 556.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.3±30.1 °C | |
| Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 556.5±50.0 °C at 760 mmHg |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.419 |
| Flash Point | 290.3±30.1 °C |
| Exact Mass | 378.179077 |
| PSA | 105.17000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | BGRHKAAVXJAPGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[(Benzyloxy)carbonyl]-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-piperidinecarboxylic acid |
| 4-tert-Butoxycarbonylamino-piperidine-1,4-dicarboxylic acid monobenzyl ester |
| 4-carboxy-N-t-butoxycarbonylbenzylamine |
| Boc-Pamb-OH |
| 1,4-Piperidinedicarboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, 1-(phenylmethyl) ester |
| 4-t-butoxycarbonylaminomethylbenzoic acid |
| 4-(Boc-amino)-1-Cbz-piperidine-4-carboxylic Acid |