CGH2466
Modify Date: 2025-08-21 16:15:33
CGH2466 structure
|
Common Name | CGH2466 | ||
|---|---|---|---|---|
| CAS Number | 252198-68-8 | Molecular Weight | 395.13400 | |
| Density | 1.45g/cm3 | Boiling Point | 480.5ºC at 760mmHg | |
| Molecular Formula | C14H11Cl4N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
Use of CGH2466A combined adenosine receptor antagonist, p38 MAPK and PDE4 inhibitor, inhibits A1, A2b and A3 receptor (IC50=19, 21 and 80 nM), p38α, p38β and PDE4D (IC50=87, 400 and 22 nM). |
| Name | 4-(3,4-dichlorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 480.5ºC at 760mmHg |
| Molecular Formula | C14H11Cl4N3S |
| Molecular Weight | 395.13400 |
| Flash Point | 244.4ºC |
| Exact Mass | 392.94300 |
| PSA | 80.04000 |
| LogP | 6.94630 |
| Vapour Pressure | 2.16E-09mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | BEPGKLOHQTXUHX-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc(Cl)c(Cl)c2)c(-c2ccncc2)s1 |
| cgh 2466 |