Ethylthiophosphonic acid O-(2,5-dichloro-4-iodophenyl)O-ethyl ester
Modify Date: 2025-08-25 16:48:40
Ethylthiophosphonic acid O-(2,5-dichloro-4-iodophenyl)O-ethyl ester structure
|
Common Name | Ethylthiophosphonic acid O-(2,5-dichloro-4-iodophenyl)O-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 25177-27-9 | Molecular Weight | 425.05000 | |
| Density | 1.718g/cm3 | Boiling Point | 401.4ºC at 760mmHg | |
| Molecular Formula | C10H12Cl2IO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.5ºC | |
| Name | (2,5-dichloro-4-iodophenoxy)-ethoxy-ethyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.718g/cm3 |
|---|---|
| Boiling Point | 401.4ºC at 760mmHg |
| Molecular Formula | C10H12Cl2IO2PS |
| Molecular Weight | 425.05000 |
| Flash Point | 196.5ºC |
| Exact Mass | 423.87200 |
| PSA | 60.36000 |
| LogP | 5.99330 |
| Vapour Pressure | 2.75E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | QKBKDXIHVRIMPV-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(CC)Oc1cc(Cl)c(I)cc1Cl |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphonothioic acid,ethyl-,O-(2,5-dichloro-4-iodophenyl) O-ethyl ester |
| (2,5-dichloro-4-iodophenoxy)-ethoxy-ethyl-sulfanylidene |