dimethyl benzene-1,4-dicarboxylate,[4-(hydroxymethyl)cyclohexyl]methanol
Modify Date: 2024-07-24 17:45:47
![dimethyl benzene-1,4-dicarboxylate,[4-(hydroxymethyl)cyclohexyl]methanol Structure](https://image.chemsrc.com/caspic/150/25135-20-0.png)
dimethyl benzene-1,4-dicarboxylate,[4-(hydroxymethyl)cyclohexyl]methanol structure
|
Common Name | dimethyl benzene-1,4-dicarboxylate,[4-(hydroxymethyl)cyclohexyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 25135-20-0 | Molecular Weight | 338.39500 | |
| Density | N/A | Boiling Point | 285ºC at 760 mmHg | |
| Molecular Formula | C18H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
| Name | dimethyl benzene-1,4-dicarboxylate,[4-(hydroxymethyl)cyclohexyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 285ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.39500 |
| Flash Point | 148ºC |
| Exact Mass | 338.17300 |
| PSA | 93.06000 |
| LogP | 2.03720 |
| Vapour Pressure | 0.00288mmHg at 25°C |
| InChIKey | KLFDLTKCAAFSAD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1.OCC1CCC(CO)CC1 |
| dimethyl benzene-1,4-dicarboxylate-cyclohexane-1,4-diyldimethanol(1:1) |
| 1,4-Benzenedicarboxylic acid,1,4-dimethyl ester,polymer with 1,4-cyclohexanedimethanol |
| 1,4-Benzenedicarboxylic acid,dimethyl ester,polymer with 1,4-cyclohexanedimethanol |