2-ethylhexyl prop-2-enoate,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid
Modify Date: 2025-09-27 18:05:31
2-ethylhexyl prop-2-enoate,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | 2-ethylhexyl prop-2-enoate,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 25133-98-6 | Molecular Weight | 370.48000 | |
| Density | N/A | Boiling Point | 216ºC at 760 mmHg | |
| Molecular Formula | C20H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.4ºC | |
| Name | 2-ethylhexyl prop-2-enoate,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 216ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.48000 |
| Flash Point | 79.4ºC |
| Exact Mass | 370.23600 |
| PSA | 89.90000 |
| LogP | 4.31460 |
| Vapour Pressure | 0.143mmHg at 25°C |
| InChIKey | DLHQZBOTVWOEED-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC.C=CC(=O)OCC(CC)CCCC |
| Methyl 2-methyl-2-propenoate,2-ethylhexyl 2-propenoate,2-methyl-2-propenoic acid terpolymer |
| Methyl methacrylate,2-ethylhexyl acrylate,methacrylic acid polymer |
| 2-Propenoic acid,2-methyl-,polymer with 2-ethylhexyl 2-propenoate and methyl 2-methyl-2-propenoate |