5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde
Modify Date: 2025-09-25 18:20:56
5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde structure
|
Common Name | 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 251300-30-8 | Molecular Weight | 269.015 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 219.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 86.3±25.9 °C | |
| Name | 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 219.1±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4BrF3O2 |
| Molecular Weight | 269.015 |
| Flash Point | 86.3±25.9 °C |
| Exact Mass | 267.934662 |
| PSA | 37.30000 |
| LogP | 3.86 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | NCOPDQCEVBJGNB-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Br)cc(C(F)(F)F)c1O |
| HS Code | 2913000090 |
|---|
|
~%
5-Bromo-2-hydro... CAS#:251300-30-8 |
| Literature: US2012/184587 A1, ; Page/Page column 10 ; |
|
~36%
5-Bromo-2-hydro... CAS#:251300-30-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 57, # 5 p. 2107 - 2120 |
|
~%
5-Bromo-2-hydro... CAS#:251300-30-8 |
| Literature: Synthesis, , # 11 p. 1878 - 1880 |
|
~%
5-Bromo-2-hydro... CAS#:251300-30-8 |
| Literature: US2012/184587 A1, ; |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| PC0843 |
| 5-bromo-2-hydroxy-3-trifluoromethylbenzaldehyde |
| 5-Bromo-2-hydroxy-3-(trifluoromethyl)benzaldehyde |
| Benzaldehyde, 5-bromo-2-hydroxy-3-(trifluoromethyl)- |