N-[(4-methylcyclohexylidene)amino]-4-nitroaniline structure
|
Common Name | N-[(4-methylcyclohexylidene)amino]-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 25117-42-4 | Molecular Weight | 247.29300 | |
| Density | 1.24g/cm3 | Boiling Point | 389.7ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | N-[(4-methylcyclohexylidene)amino]-4-nitroaniline |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760 mmHg |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.29300 |
| Flash Point | 189.5ºC |
| Exact Mass | 247.13200 |
| PSA | 70.21000 |
| LogP | 4.16900 |
| Vapour Pressure | 2.79E-06mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | QOAXQNYIPZMNIP-UHFFFAOYSA-N |
| SMILES | CC1CCC(=NNc2ccc([N+](=O)[O-])cc2)CC1 |
| HS Code | 2928000090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |