2-Propen-1-ol,3-phenyl-, phenylcarbamate (9CI)
Modify Date: 2025-08-25 13:25:43
2-Propen-1-ol,3-phenyl-, phenylcarbamate (9CI) structure
|
Common Name | 2-Propen-1-ol,3-phenyl-, phenylcarbamate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 25076-44-2 | Molecular Weight | 253.29600 | |
| Density | 1.182g/cm3 | Boiling Point | 375.8ºC at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | [(Z)-3-phenylprop-2-enyl] N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 181.1ºC |
| Exact Mass | 253.11000 |
| PSA | 38.33000 |
| LogP | 4.02150 |
| Vapour Pressure | 7.58E-06mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | DXODDGVNDLOMLO-YFHOEESVSA-N |
| SMILES | O=C(Nc1ccccc1)OCC=Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| phenyl-carbamic acid cinnamyl ester |
| Phenyl-carbamidsaeure-cinnamylester |
| cinnamyl phenylcarbamate |