Ethyl 1-bromo-2,7-naphthyridine-3-carboxylate structure
|
Common Name | Ethyl 1-bromo-2,7-naphthyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 250674-54-5 | Molecular Weight | 281.10500 | |
| Density | 1.557g/cm3 | Boiling Point | 433.922ºC at 760 mmHg | |
| Molecular Formula | C11H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.229ºC | |
| Name | Ethyl 1-bromo-2,7-naphthyridine-3-carboxylate |
|---|
| Density | 1.557g/cm3 |
|---|---|
| Boiling Point | 433.922ºC at 760 mmHg |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.10500 |
| Flash Point | 216.229ºC |
| Exact Mass | 279.98500 |
| PSA | 52.08000 |
| LogP | 2.56900 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | PWMBDHCPLLGYSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccncc2c(Br)n1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |