(R)-CFT7455
Modify Date: 2025-08-25 15:12:48
(R)-CFT7455 structure
|
Common Name | (R)-CFT7455 | ||
|---|---|---|---|---|
| CAS Number | 2504235-66-7 | Molecular Weight | 469.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H27N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-CFT7455(R)-CFT7455 is a IKZF1/3 degrader extracted from patent WO2020210630A1. (R)-CFT7455 can be used for the research of defective proteasomal degradation. |
| Name | (R)-CFT7455 |
|---|
| Description | (R)-CFT7455 is a IKZF1/3 degrader extracted from patent WO2020210630A1. (R)-CFT7455 can be used for the research of defective proteasomal degradation. |
|---|
| Molecular Formula | C28H27N3O4 |
|---|---|
| Molecular Weight | 469.53 |
| InChIKey | MUKCJOOKCZSQNW-XMMPIXPASA-N |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5ccc(CN6CCOCC6)cc5)ccc2c34)C(=O)N1 |