3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one
Modify Date: 2025-08-30 00:47:48
3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one structure
|
Common Name | 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one | ||
|---|---|---|---|---|
| CAS Number | 24979-36-0 | Molecular Weight | 228.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O |
|---|---|
| Molecular Weight | 228.29 |
| InChIKey | WGUHAEFYDBOPEH-UHFFFAOYSA-N |
| SMILES | CC12CCCCC1=NN(c1ccccc1)C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: SMILES notation of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is CC12CCCCC1=NN(c1ccccc1)C2=O. |
| Q: What is the molecular formula of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: Molecular formula of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is C14H16N2O. |
| Q: What is the molecular weight of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: Molecular weight of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is 228.29. |
| Q: What is the InChIKey of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: InChIKey of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is WGUHAEFYDBOPEH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: CAS number of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is 24979-36-0. |
| Q: What is the English name of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one? |
| A: The English name of 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one is 3a-Methyl-2-phenyl-4,5,6,7-tetrahydro-2H-indazol-3(3aH)-one. |
| Q: What is the Chinese name of 24979-36-0? |
| A: Chinese name of 24979-36-0 is 24979-36-0. |