dimethyl 3-hydroxy-5-methoxybenzene-1,2-dicarboxylate
Modify Date: 2025-08-26 17:57:45
dimethyl 3-hydroxy-5-methoxybenzene-1,2-dicarboxylate structure
|
Common Name | dimethyl 3-hydroxy-5-methoxybenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 24953-74-0 | Molecular Weight | 240.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 3-hydroxy-5-methoxybenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O6 |
|---|---|
| Molecular Weight | 240.20900 |
| Exact Mass | 240.06300 |
| PSA | 82.06000 |
| LogP | 0.97400 |
| InChIKey | TZQWWRIBBGPAPX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)cc(O)c1C(=O)OC |
| HS Code | 2918990090 |
|---|
|
~%
dimethyl 3-hydr... CAS#:24953-74-0 |
| Literature: Mcmurry,J.E.; Erion,M.D. Journal of the American Chemical Society, 1985 , vol. 107, p. 2712 |
|
~%
dimethyl 3-hydr... CAS#:24953-74-0 |
| Literature: Birch,A.J.; Wright,J.J. Australian Journal of Chemistry, 1969 , vol. 22, p. 2635 - 2644 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Benzenedicarboxylic acid,3-hydroxy-5-methoxy-,dimethyl ester |
| Dimethyl 3-hydroxy-5-methoxyphthalate |
| 2,3-dicarbomethoxy-5-methoxy-phenol |
| 3-Hydroxy-5-methoxy-phthalsaeuredimethylester |