4-Pyridinemethanol, a-phenyl-, 4-acetate structure
|
Common Name | 4-Pyridinemethanol, a-phenyl-, 4-acetate | ||
|---|---|---|---|---|
| CAS Number | 24929-18-8 | Molecular Weight | 227.25900 | |
| Density | 1.14g/cm3 | Boiling Point | 344.9ºC at 760mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | [phenyl(pyridin-4-yl)methyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 344.9ºC at 760mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 162.4ºC |
| Exact Mass | 227.09500 |
| PSA | 39.19000 |
| LogP | 2.73410 |
| Vapour Pressure | 6.4E-05mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | QRFRQXFDNNTMOU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(c1ccccc1)c1ccncc1 |
|
~%
4-Pyridinemetha... CAS#:24929-18-8 |
| Literature: Takemoto; Achiwa Chemical and Pharmaceutical Bulletin, 1994 , vol. 42, # 4 p. 802 - 805 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Phenyl-4-pyridylmethyl-acetat |
| acetoxy-phenyl-pyridin-4-yl-methane |