1,3,4-Oxadiazole,2,5-bis(2,4-dichlorophenyl)- structure
|
Common Name | 1,3,4-Oxadiazole,2,5-bis(2,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2492-00-4 | Molecular Weight | 360.02200 | |
| Density | 1.518g/cm3 | Boiling Point | 481.3ºC at 760mmHg | |
| Molecular Formula | C14H6Cl4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 2,5-bis(2,4-dichlorophenyl)-1,3,4-oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 481.3ºC at 760mmHg |
| Molecular Formula | C14H6Cl4N2O |
| Molecular Weight | 360.02200 |
| Flash Point | 244.9ºC |
| Exact Mass | 357.92300 |
| PSA | 38.92000 |
| LogP | 6.01720 |
| Vapour Pressure | 5.86E-09mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | DDMNDFNQRZDZBU-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2nnc(-c3ccc(Cl)cc3Cl)o2)c(Cl)c1 |
| HS Code | 2934999090 |
|---|
|
~%
1,3,4-Oxadiazol... CAS#:2492-00-4 |
| Literature: Indian Journal of Chemistry, , vol. 7, p. 580 - 583 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,4-oxadiazole,2,5-bis(2,4-dichlorophenyl) |
| 2,5-bis-(2,4-dichloro-phenyl)-[1,3,4]oxadiazole |