7-[3-(benzylamino)propyl]-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione structure
|
Common Name | 7-[3-(benzylamino)propyl]-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 24890-70-8 | Molecular Weight | 327.38100 | |
| Density | 1.28g/cm3 | Boiling Point | 556.3ºC at 760 mmHg | |
| Molecular Formula | C17H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.3ºC | |
| Name | 7-[3-(benzylamino)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760 mmHg |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.38100 |
| Flash Point | 290.3ºC |
| Exact Mass | 327.17000 |
| PSA | 73.85000 |
| LogP | 1.00450 |
| Vapour Pressure | 2.05E-12mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | OVKWXBYMGXFCRZ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCCNCc2ccccc2)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-(3-Benzylamino-propyl)-1,3-dimethyl-3,7-dihydro-purin-2,6-dion |
| EINECS 246-518-2 |
| 7-[3-(benzylamino)propyl]-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |
| 7-(3-(Benzylamino)propyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione |
| 7-(3-benzylamino-propyl)-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |