VITAMIN KS-II
Modify Date: 2025-08-26 17:08:11
VITAMIN KS-II structure
|
Common Name | VITAMIN KS-II | ||
|---|---|---|---|---|
| CAS Number | 2487-39-0 | Molecular Weight | 276.30800 | |
| Density | 1.39g/cm3 | Boiling Point | 483.8ºC at 760 mmHg | |
| Molecular Formula | C14H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.4ºC | |
| Name | 3-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 483.8ºC at 760 mmHg |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.30800 |
| Flash Point | 246.4ºC |
| Exact Mass | 276.04600 |
| PSA | 96.74000 |
| LogP | 2.54750 |
| Vapour Pressure | 3.58E-10mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | YQPMAEULEMJCMG-UHFFFAOYSA-N |
| SMILES | CC1=C(SCCC(=O)O)C(=O)c2ccccc2C1=O |
| HS Code | 2930909090 |
|---|
|
~82%
VITAMIN KS-II CAS#:2487-39-0 |
| Literature: Chatterjee, Moneesh; Rokita, Steven E. Journal of the American Chemical Society, 1994 , vol. 116, # 5 p. 1690 - 1697 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-Methyl-1,4-dioxo-1,4-dihydro-[2]naphthylmercapto)-propionsaeure |
| vitamin K-S(II) |
| 3-(3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-ylthio)propanoic acid |
| BIV6239 |
| 3-(3-methyl-1,4-dioxo-1,4-dihydro-[2]naphthylsulfanyl)-propionic acid |
| 3-[(3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)sulfanyl]propanoic acid |