α-Hydroxyglutaric acid-d4 disodium structure
|
Common Name | α-Hydroxyglutaric acid-d4 disodium | ||
|---|---|---|---|---|
| CAS Number | 2483831-91-8 | Molecular Weight | 196.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H2D4Na2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of α-Hydroxyglutaric acid-d4 disodiumα-Hydroxyglutaric acid-d4 (disodium) is the deuterium labeled α-Hydroxyglutaric acid disodium[1]. α-Hydroxyglutaric acid (2-Hydroxyglutarate) disodium is an α-hydroxy acid form of glutaric acid. α-Hydroxyglutaric acid disodium is a competitive inhibitor of multiple α-ketoglutarate-dependent dioxygenases, including histone demethylases and the TET family of 5-methlycytosine (5mC) hydroxylases[2]. |
| Name | α-Hydroxyglutaric acid-d4 disodium |
|---|
| Description | α-Hydroxyglutaric acid-d4 (disodium) is the deuterium labeled α-Hydroxyglutaric acid disodium[1]. α-Hydroxyglutaric acid (2-Hydroxyglutarate) disodium is an α-hydroxy acid form of glutaric acid. α-Hydroxyglutaric acid disodium is a competitive inhibitor of multiple α-ketoglutarate-dependent dioxygenases, including histone demethylases and the TET family of 5-methlycytosine (5mC) hydroxylases[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C5H2D4Na2O5 |
|---|---|
| Molecular Weight | 196.10 |
| InChIKey | UVBKSRZGVBRXSI-YHAFEQCOSA-N |
| SMILES | O=C(O)CCC(O)C(=O)O.[Na].[Na] |