m-[Bis(2-chloroethyl)amino]benzoic acid methyl ester
Modify Date: 2025-08-25 21:18:20
![m-[Bis(2-chloroethyl)amino]benzoic acid methyl ester Structure](https://image.chemsrc.com/caspic/188/24830-50-0.png)
m-[Bis(2-chloroethyl)amino]benzoic acid methyl ester structure
|
Common Name | m-[Bis(2-chloroethyl)amino]benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 24830-50-0 | Molecular Weight | 276.15900 | |
| Density | 1.249g/cm3 | Boiling Point | 394.7ºC at 760mmHg | |
| Molecular Formula | C12H15Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.5ºC | |
| Name | methyl 3-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 394.7ºC at 760mmHg |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.15900 |
| Flash Point | 192.5ºC |
| Exact Mass | 275.04800 |
| PSA | 29.54000 |
| LogP | 2.75720 |
| Vapour Pressure | 1.94E-06mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | PTUQHLMPEYWOFY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(N(CCCl)CCCl)c1 |
|
~%
m-[Bis(2-chloro... CAS#:24830-50-0 |
| Literature: Everett et al. Journal of the Chemical Society, 1953 , p. 2386,2387 |
|
~71%
m-[Bis(2-chloro... CAS#:24830-50-0 |
| Literature: Mitsui Chemicals, Inc. Patent: US5852011 A1, 1998 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| m-N-(Dichloraethylamino)-benzoesaeuremethylester |
| BENZOIC ACID,m-(BIS(2-CHLOROETHYL)AMINO)-,METHYL ESTER |
| m-(Bis(2-chloroethyl)amino)benzoic acid methyl ester |
| 3-[bis-(2-chloro-ethyl)-amino]-benzoic acid methyl ester |
| Methyl 3-((N,N-bis-(2-chloroethyl)amino))benzoate |
| Methyl-m-<bis-(2-chlor-ethyl)-amino>-benzoat |
| 3-[Bis-(2-chlor-aethyl)-amino]-benzoesaeure-methylester |