2-(1H-pyrrol-2-ylmethylidene)-1H-indol-3-one structure
|
Common Name | 2-(1H-pyrrol-2-ylmethylidene)-1H-indol-3-one | ||
|---|---|---|---|---|
| CAS Number | 248243-85-8 | Molecular Weight | 210.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1H-pyrrol-2-ylmethylidene)-1H-indol-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10N2O |
|---|---|
| Molecular Weight | 210.23100 |
| Exact Mass | 210.07900 |
| PSA | 44.89000 |
| LogP | 2.80200 |
| InChIKey | XOUWZQOFPBYBQC-UHFFFAOYSA-N |
| SMILES | O=C1C(=Cc2ccc[nH]2)Nc2ccccc21 |
|
~%
2-(1H-pyrrol-2-... CAS#:248243-85-8 |
| Literature: Ikegami, Masashi; Arai, Tatsuo Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 9 p. 1783 - 1792 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-pyrrolylidene)indolin-3-one |
| 3H-Indol-3-one,1,2-dihydro-2-(1H-pyrrol-2-ylmethylene)-,(2Z) |
| (Z)-2-(2-pyrrolylmethylidene)indolin-3-one |