2,7-dinitronaphthalene structure
|
Common Name | 2,7-dinitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 24824-27-9 | Molecular Weight | 218.16600 | |
| Density | 1.481g/cm3 | Boiling Point | 413.5ºC at 760mmHg | |
| Molecular Formula | C10H6N2O4 | Melting Point | 231-233ºC | |
| MSDS | Chinese USA | Flash Point | 216.6ºC | |
| Name | 2,7-dinitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.481g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760mmHg |
| Melting Point | 231-233ºC |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.16600 |
| Flash Point | 216.6ºC |
| Exact Mass | 218.03300 |
| PSA | 91.64000 |
| LogP | 3.70260 |
| Vapour Pressure | 1.14E-06mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | AFDWAIQLYHEUIW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ccc([N+](=O)[O-])cc2c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | UN 2811 |
| RTECS | QJ4552500 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2904209090 |
|
~%
2,7-dinitronaph... CAS#:24824-27-9 |
| Literature: Hodgson; Ward; Whitehurst Journal of the Chemical Society, 1945 , p. 454 |
|
~%
2,7-dinitronaph... CAS#:24824-27-9 |
| Literature: Hodgson; Ward; Whitehurst Journal of the Chemical Society, 1945 , p. 454 |
|
~%
2,7-dinitronaph... CAS#:24824-27-9 |
| Literature: Hodgson; Ward; Whitehurst Journal of the Chemical Society, 1945 , p. 454 |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Electron transfer within charge-localized dinitroaromatic radical anions.
J. Phys. Chem. A 113(27) , 7730-6, (2009) Rate constants for the intramolecular electron-transfer reaction in the 2,7-dinitronaphthalene (2(-)), 4,4'-dinitrotolane (3(-)), and 2,2'-dimethyl-4,4'-dinitrobiphenyl (4(-)) radical anions in severa... |
|
|
Selectivity in capillary electrochromatography using native and single isomer anionic cyclodextrin reagents.
Anal. Chem. 72(1) , 88-95, (2000) Separations of naphthalene compounds that differ in position of substitution and type of substituent were accomplished using cyclodextrin distribution capillary electrochromatography. Separation syste... |
|
|
107. The further nitration of 1: 3-, 1: 6-, 2: 6-, and 2: 7-dinitronaphthalenes, and the preparation of 1: 3: 6-trinitronaphthalene. Edward, R.
J. Chem. Soc. , 533-34, (1946)
|
| 2,7-dinitro-naphthalene |
| Naphthalene,2,7-dinitro |
| 1,7-Dinitronaphthalin |
| 2,7-DINITRONAPHTHALENE |
| 2,7-Dinitronaphthalin |
| EINECS 246-480-7 |
| 2,5-DIMETHYLPHENYLACETONE |