L-Iditol,1,4:3,6-dianhydro-, dimethanesulfonate (9CI)
Modify Date: 2025-09-05 20:42:35
L-Iditol,1,4:3,6-dianhydro-, dimethanesulfonate (9CI) structure
|
Common Name | L-Iditol,1,4:3,6-dianhydro-, dimethanesulfonate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 24808-19-3 | Molecular Weight | 302.32200 | |
| Density | 1.58g/cm3 | Boiling Point | 564.3ºC at 760 mmHg | |
| Molecular Formula | C8H14O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
| Name | (6-methylsulfonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 564.3ºC at 760 mmHg |
| Molecular Formula | C8H14O8S2 |
| Molecular Weight | 302.32200 |
| Flash Point | 295.1ºC |
| Exact Mass | 302.01300 |
| PSA | 121.96000 |
| LogP | 0.63520 |
| Vapour Pressure | 3.57E-12mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | CFHDLWAMOHQNTF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1COC2C(OS(C)(=O)=O)COC12 |
|
~10%
L-Iditol,1,4:3,... CAS#:24808-19-3 |
| Literature: De Coster, Gert; Vandyck, Koen; Van der Eycken, Erik; Van der Eycken, Johan; Elseviers, Myriam; Roeper, Harald Tetrahedron Asymmetry, 2002 , vol. 13, # 15 p. 1673 - 1679 |
|
~%
L-Iditol,1,4:3,... CAS#:24808-19-3 |
| Literature: Wiggins Journal of the Chemical Society, 1947 , p. 1403 |
|
~%
L-Iditol,1,4:3,... CAS#:24808-19-3 |
| Literature: De Coster, Gert; Vandyck, Koen; Van der Eycken, Erik; Van der Eycken, Johan; Elseviers, Myriam; Roeper, Harald Tetrahedron Asymmetry, 2002 , vol. 13, # 15 p. 1673 - 1679 |
![(3S,3aR,6S,6aR)-6-(benzoyloxy)hexahydrofuro[3,2-b]furan-3-yl benzoate structure](https://image.chemsrc.com/caspic/025/3014-56-0.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3S,3aS,6S,6aS)-6-[(methylsulfonyl)oxy]hexahydrofuro[3,2-b]furan-3-yl methanesulfonate |
| 1-[2-(ethyl{4-[(e)-(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]phenyl}amino)ethyl]pyridiniumchloride |
| 1-(2-(N-Ethyl-p-((3-phenyl-1,2,4-thiadiazol-5-yl)azo)anilino)ethyl)pyridinium chloride |
| Bis-O-methansulfonyl-1,4,3,6-dianhydro-D-mannit |
| bis-O-methanesulfonyl-1,4,3,6-dianhydro-L-iditol |
| Bis-O-methansulfonyl-1,4,3,6-dianhydro-L-idit |
| bis-O-methanesulfonyl-1,4,3,6-dianhydro-D-mannitol |
| 1,4:3,6-dianhydro-2,5-di-O-mesyl-D-mannitol |