N-benzyl-2-(3,4,5-trimethoxyphenoxy)acetamide
Modify Date: 2025-09-07 18:53:04
N-benzyl-2-(3,4,5-trimethoxyphenoxy)acetamide structure
|
Common Name | N-benzyl-2-(3,4,5-trimethoxyphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 24789-76-2 | Molecular Weight | 331.36300 | |
| Density | 1.162g/cm3 | Boiling Point | 548ºC at 760mmHg | |
| Molecular Formula | C18H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.2ºC | |
| Name | N-benzyl-2-(3,4,5-trimethoxyphenoxy)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 548ºC at 760mmHg |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.36300 |
| Flash Point | 285.2ºC |
| Exact Mass | 331.14200 |
| PSA | 69.51000 |
| LogP | 3.24790 |
| Vapour Pressure | 4.62E-12mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | GKRGVOGWPNHCLX-UHFFFAOYSA-N |
| SMILES | COc1cc(OCC(=O)NCc2ccccc2)cc(OC)c1OC |
|
~%
N-benzyl-2-(3,4... CAS#:24789-76-2 |
| Literature: Protiva; Valenta; Trcka; et al. Collection of Czechoslovak Chemical Communications, 1977 , vol. 42, # 12 p. 3628 - 3642 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-Benzyl-3,4,5-trimethoxyphenoxyacetamid |
| N-Benzyl-3,4,5-trimethoxyphenoxyacetamide |
| N-(Phenylmethyl)-2-(3,4,5-trimethoxyphenoxy)acetamide |
| (3,4,5-Trimethoxyphenoxy)-essigsaeure-benzylcyanid |
| Acetamide,N-(phenylmethyl)-2-(3,4,5-trimethoxyphenoxy) |