chloropractolol
Modify Date: 2025-09-17 22:52:40
chloropractolol structure
|
Common Name | chloropractolol | ||
|---|---|---|---|---|
| CAS Number | 24789-03-5 | Molecular Weight | 300.78100 | |
| Density | 1.215g/cm3 | Boiling Point | 539.1ºC at 760mmHg | |
| Molecular Formula | C14H21ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.9ºC | |
| Name | 2-chloro-N-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 539.1ºC at 760mmHg |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.78100 |
| Flash Point | 279.9ºC |
| Exact Mass | 300.12400 |
| PSA | 70.59000 |
| LogP | 2.06550 |
| Vapour Pressure | 1.87E-12mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | HTVYZYZSMGPSAR-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1ccc(NC(=O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (+-)-1-<4-Chloracetyl-amino-phenoxy>-3-isopropylamino-propan-2-ol |
| Acetamide,2-chloro-N-(4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)phenyl) |
| 3-(4-Chloracetamidophenoxy)-1-isopropylaminopropan-2-ol |
| Chloropractolol |