Z-SER-ALA-OH structure
|
Common Name | Z-SER-ALA-OH | ||
|---|---|---|---|---|
| CAS Number | 24787-87-9 | Molecular Weight | 310.30300 | |
| Density | 1.335g/cm3 | Boiling Point | 640.9ºC at 760mmHg | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.4ºC | |
| Name | 2-[[3-hydroxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 640.9ºC at 760mmHg |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.30300 |
| Flash Point | 341.4ºC |
| Exact Mass | 310.11600 |
| PSA | 124.96000 |
| LogP | 0.64480 |
| Vapour Pressure | 2.64E-17mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | VWPKWOHWTBYMEQ-ONGXEEELSA-N |
| SMILES | CC(NC(=O)C(CO)NC(=O)OCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~81%
Z-SER-ALA-OH CAS#:24787-87-9 |
| Literature: Braun, Peter; Waldmann, Herbert; Vogt, Walter; Kunz, Horst Liebigs Annalen der Chemie, 1991 , # 2 p. 165 - 170 |
|
~%
Z-SER-ALA-OH CAS#:24787-87-9 |
| Literature: Fruton Journal of Biological Chemistry, 1942 , vol. 146, p. 463,469 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzyloxycarbonyl-L-seryl-L-alanin |
| N-(N-Benzyloxycarbonyl-L-seryl)-L-alanin |
| 2-(2-(benzyloxycarbonylamino)-3-hydroxy propanamido)propanoic acid |
| N-(N-benzyloxycarbonyl-L-seryl)-L-alanine |
| Z-SER-ALA-OH |