6-amino-2-(2,4-dimethylphenyl)-1H-benz[de]isoquinoline-1,3(2H)-dione structure
|
Common Name | 6-amino-2-(2,4-dimethylphenyl)-1H-benz[de]isoquinoline-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 2478-20-8 | Molecular Weight | 316.35300 | |
| Density | 1.342 g/cm3 | Boiling Point | 591.4ºC at 760 mmHg | |
| Molecular Formula | C20H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.5ºC | |
| Name | 6-amino-2-(2,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342 g/cm3 |
|---|---|
| Boiling Point | 591.4ºC at 760 mmHg |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.35300 |
| Flash Point | 311.5ºC |
| Exact Mass | 316.12100 |
| PSA | 65.09000 |
| LogP | 3.72210 |
| Vapour Pressure | 5.85E-14mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | FQLZTPSAVDHUKS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)c3cccc4c(N)ccc(c34)C2=O)c(C)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| C.I. solvent yellow 44 |
| 4-aminonaphthalene-1,8-dicarboxylic acid 2,4-dimethylphenylimide |
| solvent yellow 44 |
| C Yellow 11 |