3,4-dihydro-4-isopropyl-2,2-dimethyl-7-octyl-2H-1-benzopyran-6-ol
Modify Date: 2025-08-26 13:06:00
3,4-dihydro-4-isopropyl-2,2-dimethyl-7-octyl-2H-1-benzopyran-6-ol structure
|
Common Name | 3,4-dihydro-4-isopropyl-2,2-dimethyl-7-octyl-2H-1-benzopyran-6-ol | ||
|---|---|---|---|---|
| CAS Number | 24700-85-4 | Molecular Weight | 332.52000 | |
| Density | 0.955g/cm3 | Boiling Point | 428.2ºC at 760mmHg | |
| Molecular Formula | C22H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8ºC | |
| Name | 2,2-dimethyl-7-octyl-4-propan-2-yl-3,4-dihydrochromen-6-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.955g/cm3 |
|---|---|
| Boiling Point | 428.2ºC at 760mmHg |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.52000 |
| Flash Point | 166.8ºC |
| Exact Mass | 332.27200 |
| PSA | 29.46000 |
| LogP | 6.59590 |
| Vapour Pressure | 6.18E-08mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | JYZPSBQSMQQYOB-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cc2c(cc1O)C(C(C)C)CC(C)(C)O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-isopropyl-2,2-dimethyl-7-octylchroman-6-ol |
| 3,4-dihydro-4-isopropyl-2,2-dimethyl-7-octyl-2H-1-benzopyran-6-ol |
| EINECS 246-423-6 |