2-(2-Chlorophenyl)-1,2-dihydro-5-phenyl-3H-1,2,4-triazol-3-one
Modify Date: 2025-10-14 11:04:34
2-(2-Chlorophenyl)-1,2-dihydro-5-phenyl-3H-1,2,4-triazol-3-one structure
|
Common Name | 2-(2-Chlorophenyl)-1,2-dihydro-5-phenyl-3H-1,2,4-triazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 246848-58-8 | Molecular Weight | 271.70200 | |
| Density | 1.363g/cm3 | Boiling Point | 386.506ºC at 760 mmHg | |
| Molecular Formula | C14H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.552ºC | |
| Name | 2-(2-chlorophenyl)-5-phenyl-1H-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 386.506ºC at 760 mmHg |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.70200 |
| Flash Point | 187.552ºC |
| Exact Mass | 271.05100 |
| PSA | 50.68000 |
| LogP | 2.88100 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | WXAFVRHIIVGONB-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2)nn1-c1ccccc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-chlorophenyl)-5-phenyl-3H-1,2,4-triazol-3-one |
| 3H-1,2,4-Triazol-3-one,2-(2-chlorophenyl)-1,2-dihydro-5-phenyl |
| 2-(2-Chlorophenyl)-1,2-dihydro-5-phenyl-3H-1,2,4-triazol-3-one |
| 2-((BENZYLOXY)CARBONYL)-1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBOXYLIC ACID |
| 2-(2-Chlorophenyl)-1,2-dihydro-5-phenyl-3H-1,2,4 |