5-methyl-2-phenyl-3-sulfanylidene-1H-pyrazole-4-carbaldehyde structure
|
Common Name | 5-methyl-2-phenyl-3-sulfanylidene-1H-pyrazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 24628-79-3 | Molecular Weight | 218.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-2-phenyl-3-sulfanylidene-1H-pyrazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2OS |
|---|---|
| Molecular Weight | 218.27500 |
| Exact Mass | 218.05100 |
| PSA | 69.88000 |
| LogP | 2.65580 |
| InChIKey | JLLWHWZULBAOQY-UHFFFAOYSA-N |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=S)c1C=O |
|
~%
5-methyl-2-phen... CAS#:24628-79-3 |
| Literature: Nivorozhkin, Alexander L.; Toftlund, Hans; Nielsen, Max Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1994 , # 3 p. 361 - 368 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-methyl-1-phenyl-5-sulfanylpyrazole-4-carbaldehyde |
| 1H-Pyrazole-4-carboxaldehyde,5-mercapto-3-methyl-1-phenyl |
| 4-formyl-3-methyl-1-phenyl-5-sulfanylpyrazole |
| 5-methyl-2-phenyl-3-thioxo-2,3-dihydro-1H-pyrazole-4-carbaldehyde |
| 3-methyl-1-phenyl-5-sulfanyl-1H-pyrazole-4-carbaldehyde |
| 3-methyl-5-mercapto-1-phenylpyrazol-4-carboxaldehyde |