Indol-3-ylacetylaspartic acid structure
|
Common Name | Indol-3-ylacetylaspartic acid | ||
|---|---|---|---|---|
| CAS Number | 2456-73-7 | Molecular Weight | 290.271 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 641.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.9±31.5 °C | |
| Name | (2S)-2-[[2-(1H-indol-3-yl)acetyl]amino]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 641.7±55.0 °C at 760 mmHg |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.271 |
| Flash Point | 341.9±31.5 °C |
| Exact Mass | 290.090271 |
| PSA | 122.98000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | VAFNMNRKDDAKRM-NSHDSACASA-N |
| SMILES | O=C(O)CC(NC(=O)Cc1c[nH]c2ccccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(1H-Indol-3-ylacetyl)aspartic acid |
| Indol-3-ylacetylaspartic acid |
| N-[1H-INDOL-3-YL-ACETYL]ASPARTIC ACID |
| IAASP |
| Indolyl-3-aspartic acid |
| IAA-L-Asp |
| Indoleacetylaspartate |
| Aspartic acid, N-[2-(1H-indol-3-yl)acetyl]- |
| (Indole-3-acetyl)aspartic acid |