decyl hydrogen phthalate structure
|
Common Name | decyl hydrogen phthalate | ||
|---|---|---|---|---|
| CAS Number | 24539-60-4 | Molecular Weight | 306.39700 | |
| Density | 1.062g/cm3 | Boiling Point | 439.8ºC at 760mmHg | |
| Molecular Formula | C18H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.1ºC | |
| Name | 2-decoxycarbonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 439.8ºC at 760mmHg |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.39700 |
| Flash Point | 151.1ºC |
| Exact Mass | 306.18300 |
| PSA | 63.60000 |
| LogP | 4.68230 |
| Vapour Pressure | 1.64E-08mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | FEFCILUKYGHITK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
decyl hydrogen ... CAS#:24539-60-4 |
| Literature: Scholz, Norbert Chemosphere, 2003 , vol. 53, # 8 p. 921 - 926 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-Phthalsaeuremonodecylester |
| Phthalsaeuredecylester |
| Phthalsaeure-mono-decylester |
| mono-n-decyl phthalate |
| phthalic acid mono-decyl ester |
| 2-(decyloxycarbonyl)benzoic acid |
| Decyl hydrogen phthalate |
| 1,2-benzenedicarboxylic acid,monodecyl ester |