2-(4-chloro-2-methylphenoxy)-N-(2-chlorophenyl)acetamide
Modify Date: 2025-09-20 17:29:50
2-(4-chloro-2-methylphenoxy)-N-(2-chlorophenyl)acetamide structure
|
Common Name | 2-(4-chloro-2-methylphenoxy)-N-(2-chlorophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 2453-96-5 | Molecular Weight | 310.17500 | |
| Density | 1.342g/cm3 | Boiling Point | 496.5ºC at 760mmHg | |
| Molecular Formula | C15H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | 2-(4-chloro-2-methylphenoxy)-N-(2-chlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760mmHg |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.17500 |
| Flash Point | 254.1ºC |
| Exact Mass | 309.03200 |
| PSA | 41.82000 |
| LogP | 4.96880 |
| Vapour Pressure | 5.39E-10mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | HLCZVFNOYLCIEX-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide,2-(4-chloro-2-methylphenoxy)-N-(2-chlorophenyl) |