1-thiophen-2-yl-N-(1-thiophen-2-ylethylideneamino)ethanimine structure
|
Common Name | 1-thiophen-2-yl-N-(1-thiophen-2-ylethylideneamino)ethanimine | ||
|---|---|---|---|---|
| CAS Number | 24523-54-4 | Molecular Weight | 248.36700 | |
| Density | 1.2g/cm3 | Boiling Point | 342.6ºC at 760 mmHg | |
| Molecular Formula | C12H12N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | (E)-1-thiophen-2-yl-N-[(E)-1-thiophen-2-ylethylideneamino]ethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 342.6ºC at 760 mmHg |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.36700 |
| Flash Point | 161ºC |
| Exact Mass | 248.04400 |
| PSA | 81.20000 |
| LogP | 4.04280 |
| Vapour Pressure | 0.000148mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | CVPWLODMVVPHSM-UTLPMFLDSA-N |
| SMILES | CC(=NN=C(C)c1cccs1)c1cccs1 |
|
~83%
1-thiophen-2-yl... CAS#:24523-54-4 |
| Literature: El-Alali, Abdullah; Al-Kamali, Ahmed S. Canadian Journal of Zoology, 2002 , vol. 80, # 10 p. 1293 - 1301 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-bromoethyl thiolacetate |
| S-acetyl-2-bromoethanethiol |
| 2-bromoethyl thioacetate |
| S-2-bromoethyl thioacetate |
| Acetic acid,thio-,S-2-bromoethyl ester |
| 2-acetylthioethyl bromide |
| 1-bromoethanethiol acetate |
| 2-acetylthiophene azine |
| 2-Acetylthiophenketazin |