Benzenesulfonic acid,4-methyl-, 2-(2,4,6-cycloheptatrien-1-ylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(2,4,6-cycloheptatrien-1-ylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 24480-73-7 | Molecular Weight | 274.33800 | |
| Density | 1.19g/cm3 | Boiling Point | 450.5ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.2ºC | |
| Name | N-(cyclohepta-2,4,6-trien-1-ylideneamino)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 450.5ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.33800 |
| Flash Point | 226.2ºC |
| Exact Mass | 274.07800 |
| PSA | 66.91000 |
| LogP | 3.26090 |
| Vapour Pressure | 2.63E-08mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | QTAUOJDSHRYRMF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=c2cccccc2)cc1 |
|
~80%
Benzenesulfonic... CAS#:24480-73-7 |
| Literature: Kajigaeshi, Shoji; Matsuoka, Shingo; Kanemasa, Shuji; Noguchi, Michihiko Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 49 - 52 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| N-(1-CYCLOHEPTA-2,4,6-TRIENYLIDENEAMINO)-4-METHYL-BENZENESULFONAMIDE |
| Tropontosylhydrazon |
| tropone tosylhydrazone |