THR-β agonist 2
Modify Date: 2025-08-27 11:05:02
THR-β agonist 2 structure
|
Common Name | THR-β agonist 2 | ||
|---|---|---|---|---|
| CAS Number | 2440027-77-8 | Molecular Weight | 443.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H8Cl2N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of THR-β agonist 2THR-β agonist 2 is a potent agonist of THR-β. THR-β agonist 2 has the potential for the research of metabolic diseases such as obesity, hyperlipidemia, hypercholesterolemia, diabetes and other conditions such as steatosis and non-alcoholic steatohepatitis (NASH), atherosclerosis and other related conditions and diseases (extracted from patent WO2021121210A1, compound 3)[1]. |
| Name | THR-β agonist 2 |
|---|
| Description | THR-β agonist 2 is a potent agonist of THR-β. THR-β agonist 2 has the potential for the research of metabolic diseases such as obesity, hyperlipidemia, hypercholesterolemia, diabetes and other conditions such as steatosis and non-alcoholic steatohepatitis (NASH), atherosclerosis and other related conditions and diseases (extracted from patent WO2021121210A1, compound 3)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H8Cl2N6O4 |
|---|---|
| Molecular Weight | 443.20 |
| InChIKey | FJQQQWSZHAKGKZ-UHFFFAOYSA-N |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3n[nH]c(=O)c4ccccc34)c(Cl)c2)c(=O)[nH]c1=O |