D-glucitol, compound with iron(3+) citrate structure
|
Common Name | D-glucitol, compound with iron(3+) citrate | ||
|---|---|---|---|---|
| CAS Number | 24390-15-6 | Molecular Weight | 430.14000 | |
| Density | N/A | Boiling Point | 309.6ºC at 760 mmHg | |
| Molecular Formula | C12H22FeO13+++ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
| Name | hexane-1,2,3,4,5,6-hexol,2-hydroxypropane-1,2,3-tricarboxylic acid,iron(3+) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 309.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H22FeO13+++ |
| Molecular Weight | 430.14000 |
| Flash Point | 155.2ºC |
| Exact Mass | 430.04100 |
| PSA | 253.51000 |
| Vapour Pressure | 5.73E-05mmHg at 25°C |
| InChIKey | WNDUPUMWHYAJOR-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.OCC(O)C(O)C(O)C(O)CO.[Fe+3] |
| D-Glucitol,compound with iron(3+) citrate |
| EINECS 246-217-6 |