4'-Chloro-α-(diethylhydrazono)acetophenone
Modify Date: 2024-07-16 10:17:17
4'-Chloro-α-(diethylhydrazono)acetophenone structure
|
Common Name | 4'-Chloro-α-(diethylhydrazono)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 24346-21-2 | Molecular Weight | 238.71300 | |
| Density | 1.09g/cm3 | Boiling Point | 343.2ºC at 760mmHg | |
| Molecular Formula | C12H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | (2E)-1-(4-chlorophenyl)-2-(diethylhydrazinylidene)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 343.2ºC at 760mmHg |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.71300 |
| Flash Point | 161.4ºC |
| Exact Mass | 238.08700 |
| PSA | 32.67000 |
| LogP | 2.85030 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | LVHCUONWHLDNDW-NTEUORMPSA-N |
| SMILES | CCN(CC)N=CC(=O)c1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
4'-Chloro-α-(di... CAS#:24346-21-2 |
| Literature: Journal of medicinal chemistry, , vol. 13, # 1 p. 157 - 159 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-Chlorophenylglyoxal N,N-diethylhydrazone |
| 4-Chlorophenylglyoxal N,N-diethylhydrazone |
| GLYOXAL,p-CHLOROPHENYL-,DIETHYL HYDRAZONE |