Benzenedecanoic acid, 4-hydroxy-3-methyl-i-oxo- structure
|
Common Name | Benzenedecanoic acid, 4-hydroxy-3-methyl-i-oxo- | ||
|---|---|---|---|---|
| CAS Number | 24339-89-7 | Molecular Weight | 292.37000 | |
| Density | 1.114g/cm3 | Boiling Point | 506.2ºC at 760mmHg | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.1ºC | |
| Name | 10-(4-hydroxy-3-methylphenyl)-10-oxodecanoic acid |
|---|
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 506.2ºC at 760mmHg |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37000 |
| Flash Point | 274.1ºC |
| Exact Mass | 292.16700 |
| PSA | 74.60000 |
| LogP | 4.08870 |
| Vapour Pressure | 4.52E-11mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | WCUPIBJMBMQKDQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)CCCCCCCCC(=O)O)ccc1O |
|
~%
Benzenedecanoic... CAS#:24339-89-7 |
| Literature: Chakravarti,D.; Chakravarti,A. Journal of the Indian Chemical Society, 1969 , vol. 46, # 8 p. 743 - 748 |
|
~%
Benzenedecanoic... CAS#:24339-89-7 |
| Literature: Chakravarti,D.; Chakravarti,A. Journal of the Indian Chemical Society, 1969 , vol. 46, # 8 p. 743 - 748 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |