1,3-Propanediol,2-(1,1-dimethylethyl)-, 1,3-bis(4-methylbenzenesulfonate)
Modify Date: 2025-10-13 19:00:07
1,3-Propanediol,2-(1,1-dimethylethyl)-, 1,3-bis(4-methylbenzenesulfonate) structure
|
Common Name | 1,3-Propanediol,2-(1,1-dimethylethyl)-, 1,3-bis(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 24330-56-1 | Molecular Weight | 440.57300 | |
| Density | 1.216g/cm3 | Boiling Point | 582.2ºC at 760mmHg | |
| Molecular Formula | C21H28O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.9ºC | |
| Name | [3,3-dimethyl-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 582.2ºC at 760mmHg |
| Molecular Formula | C21H28O6S2 |
| Molecular Weight | 440.57300 |
| Flash Point | 305.9ºC |
| Exact Mass | 440.13300 |
| PSA | 103.50000 |
| LogP | 6.23810 |
| Vapour Pressure | 6.16E-13mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | OEBLYZFSZBMRJT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COS(=O)(=O)c2ccc(C)cc2)C(C)(C)C)cc1 |
|
~%
1,3-Propanediol... CAS#:24330-56-1 |
| Literature: Karimine, Mohamed; Galsomias, Jacqueline; Lere-Porte, Jean-Pierre; Petrissans, Jean Journal of Molecular Structure, 1987 , vol. 162, p. 321 - 332 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:24330-57-2| 2-tert-Butyl-1.3-propandiol-ditosylat |
| 2-t-Butyl-1,3-propandiol-ditosylat |
| 2-tert-butyl-1,3-propanediol di-p-tosylate |
| 2-tert-Butyl-propandiol-1,3-ditosylat |