(2E)-4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluoro-2-nonenoic acid
Modify Date: 2025-09-29 00:50:00
(2E)-4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluoro-2-nonenoic acid structure
|
Common Name | (2E)-4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluoro-2-nonenoic acid | ||
|---|---|---|---|---|
| CAS Number | 243139-70-0 | Molecular Weight | 390.09800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H3F13O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E)-4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluoro-2-nonenoic acid |
|---|
| Molecular Formula | C9H3F13O2 |
|---|---|
| Molecular Weight | 390.09800 |
| Exact Mass | 389.99300 |
| PSA | 37.30000 |
| LogP | 4.36600 |
| InChIKey | PYWWUCKTKBAQOL-OWOJBTEDSA-N |
| SMILES | O=C(O)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |